BG0
(4R)-2,7,8-triamino-4-(3-bromo-4,5-dimethoxyphenyl)-4H-1-benzopyran-3-carbonitrile
Find entries where: BG0
is present as a standalone ligand in 1 entries
Chemical Component Summary | |
|---|---|
| Name | (4R)-2,7,8-triamino-4-(3-bromo-4,5-dimethoxyphenyl)-4H-1-benzopyran-3-carbonitrile |
| Identifiers | (4~{R})-2,7,8-tris(azanyl)-4-(3-bromanyl-4,5-dimethoxy-phenyl)-4~{H}-chromene-3-carbonitrile |
| Formula | C18 H17 Br N4 O3 |
| Molecular Weight | 417.257 |
| Type | NON-POLYMER |
| Isomeric SMILES | COc1cc(cc(c1OC)Br)[C@@H]2c3ccc(c(c3OC(=C2C#N)N)N)N |
| InChI | InChI=1S/C18H17BrN4O3/c1-24-13-6-8(5-11(19)17(13)25-2)14-9-3-4-12(21)15(22)16(9)26-18(23)10(14)7-20/h3-6,14H,21-23H2,1-2H3/t14-/m1/s1 |
| InChIKey | JXONINOYTKKXQQ-CQSZACIVSA-N |
Chemical Details | |
|---|---|
| Formal Charge | 0 |
| Atom Count | 43 |
| Chiral Atom Count | 1 |
| Bond Count | 45 |
| Aromatic Bond Count | 12 |
Drug Info: DrugBank
| DrugBank ID | DB12925 |
|---|---|
| Name | Crolibulin |
| Groups | investigational |
| Description | Crolibulin has been used in trials studying the treatment of Solid Tumor and Anaplastic Thyroid Cancer. |
| Synonyms | Crolibulin |
| Categories |
|
| CAS number | 1000852-17-4 |
Related Resource References
| Resource Name | Reference |
|---|---|
| PubChem | 23649181 |
| ChEMBL | CHEMBL2103852 |
