ZZE
5-{[3,5-diethyl-1-(2-hydroxyethyl)-1H-pyrazol-4-yl]oxy}benzene-1,3-dicarbonitrile
Find entries where: ZZE
is present as a standalone ligand in 2 entries
Chemical Component Summary | |
|---|---|
| Name | 5-{[3,5-diethyl-1-(2-hydroxyethyl)-1H-pyrazol-4-yl]oxy}benzene-1,3-dicarbonitrile |
| Identifiers | 5-[3,5-diethyl-1-(2-hydroxyethyl)pyrazol-4-yl]oxybenzene-1,3-dicarbonitrile |
| Formula | C17 H18 N4 O2 |
| Molecular Weight | 310.35 |
| Type | NON-POLYMER |
| Isomeric SMILES | CCc1c(c(n(n1)CCO)CC)Oc2cc(cc(c2)C#N)C#N |
| InChI | InChI=1S/C17H18N4O2/c1-3-15-17(16(4-2)21(20-15)5-6-22)23-14-8-12(10-18)7-13(9-14)11-19/h7-9,22H,3-6H2,1-2H3 |
| InChIKey | MCPUZZJBAHRIPO-UHFFFAOYSA-N |
Chemical Details | |
|---|---|
| Formal Charge | 0 |
| Atom Count | 41 |
| Chiral Atom Count | 0 |
| Bond Count | 42 |
| Aromatic Bond Count | 11 |
Drug Info: DrugBank
| DrugBank ID | DB11649 |
|---|---|
| Name | Lersivirine |
| Groups | investigational |
| Description | Lersivirine has been used in trials studying the treatment of HIV-1. |
| Synonyms | Lersivirine |
| Categories | RNA-Directed DNA Polymerase |
| CAS number | 473921-12-9 |
Related Resource References
| Resource Name | Reference |
|---|---|
| PubChem | 16739244 |
| ChEMBL | CHEMBL571987 |
