022
3-{1-(4-carbamoyl-2-methylphenyl)-5-[4-(1H-imidazol-1-yl)phenyl]-1H-pyrrol-2-yl}propanoic acid
Find entries where: 022
is present as a standalone ligand in 1 entries
Chemical Component Summary | |
|---|---|
| Name | 3-{1-(4-carbamoyl-2-methylphenyl)-5-[4-(1H-imidazol-1-yl)phenyl]-1H-pyrrol-2-yl}propanoic acid |
| Synonyms | N6022 |
| Identifiers | 3-[1-(4-aminocarbonyl-2-methyl-phenyl)-5-(4-imidazol-1-ylphenyl)pyrrol-2-yl]propanoic acid |
| Formula | C24 H22 N4 O3 |
| Molecular Weight | 414.456 |
| Type | NON-POLYMER |
| Isomeric SMILES | Cc1cc(ccc1n2c(ccc2c3ccc(cc3)n4ccnc4)CCC(=O)O)C(=O)N |
| InChI | InChI=1S/C24H22N4O3/c1-16-14-18(24(25)31)4-9-21(16)28-20(8-11-23(29)30)7-10-22(28)17-2-5-19(6-3-17)27-13-12-26-15-27/h2-7,9-10,12-15H,8,11H2,1H3,(H2,25,31)(H,29,30) |
| InChIKey | YVPGZQLRPAGKLA-UHFFFAOYSA-N |
Chemical Details | |
|---|---|
| Formal Charge | 0 |
| Atom Count | 53 |
| Chiral Atom Count | 0 |
| Bond Count | 56 |
| Aromatic Bond Count | 25 |
Drug Info: DrugBank
| DrugBank ID | DB12206 |
|---|---|
| Name | N-6022 |
| Groups | investigational |
| Description | N6022 has been used in trials studying the treatment of Asthma and Cystic Fibrosis. |
| Synonyms | N-6022 |
| Categories |
|
| CAS number | 1208315-24-5 |
Related Resource References
| Resource Name | Reference |
|---|---|
| Pharos | CHEMBL1738699 |
| PubChem | 44623946 |
| ChEMBL | CHEMBL1738699 |
