Chemical Component Summary | |
|---|---|
| Name | Sacubitrilat |
| Synonyms | LBQ657 |
| Identifiers | (2~{R},4~{S})-2-methyl-4-[(4-oxidanyl-4-oxidanylidene-butanoyl)amino]-5-(4-phenylphenyl)pentanoic acid |
| Formula | C22 H25 N O5 |
| Molecular Weight | 383.438 |
| Type | NON-POLYMER |
| Isomeric SMILES | C[C@H](C[C@@H](Cc1ccc(cc1)c2ccccc2)NC(=O)CCC(=O)O)C(=O)O |
| InChI | InChI=1S/C22H25NO5/c1-15(22(27)28)13-19(23-20(24)11-12-21(25)26)14-16-7-9-18(10-8-16)17-5-3-2-4-6-17/h2-10,15,19H,11-14H2,1H3,(H,23,24)(H,25,26)(H,27,28)/t15-,19+/m1/s1 |
| InChIKey | DOBNVUFHFMVMDB-BEFAXECRSA-N |
Chemical Details | |
|---|---|
| Formal Charge | 0 |
| Atom Count | 53 |
| Chiral Atom Count | 2 |
| Bond Count | 54 |
| Aromatic Bond Count | 12 |
Drug Info: DrugBank
| DrugBank ID | DB14127 |
|---|---|
| Name | Sacubitrilat |
| Groups | experimental |
| Description | A metabolite of LCZ696 with neprilysin inhibitory activity. |
| Synonyms | Sacubitrilat |
| Categories |
|
| CAS number | 149709-44-4 |
Related Resource References
| Resource Name | Reference |
|---|---|
| Pharos | CHEMBL417007 |
| PubChem | 10430040 |
| ChEMBL | CHEMBL417007 |
