CHL
CHLOROPHYLL B
Find entries where: CHL
is present as a standalone ligand in 93 entries
as a non-polymer is covalently linked to polymer or other heterogen groups 7 entries
Chemical Component Summary | |
|---|---|
| Name | CHLOROPHYLL B |
| Formula | C55 H70 Mg N4 O6 |
| Molecular Weight | 907.472 |
| Type | NON-POLYMER |
| Isomeric SMILES | CCC1=C(c2cc3c(c(c4n3[Mg]56[n+]2c1cc7n5c8c(c9[n+]6c(c4)C(C9CCC(=O)OC/C=C(\C)/CCC[C@H](C)CCC[C@H](C)CCCC(C)C)C)[C@H](C(=O)c8c7C)C(=O)OC)C)C=C)C=O |
| InChI | InChI=1S/C55H71N4O6.Mg/c1-12-38-35(8)42-27-43-36(9)40(23-24-48(61)65-26-25-34(7)22-16-21-33(6)20-15-19-32(5)18-14-17-31(3)4)52(58-43)50-51(55(63)64-11)54(62)49-37(10)44(59-53(49)50)28-46-39(13-2)41(30-60)47(57-46)29-45(38)56-42;/h12,25,27-33,36,40,51H,1,13-24,26H2,2-11H3,(H-,56,57,58,59,60,62);/q-1;+4/p-1/b34-25+;/t32-,33-,36?,40?,51-;/m1./s1 |
| InChIKey | MWVCRINOIIOUAU-UYSPMESUSA-M |
Chemical Details | |
|---|---|
| Formal Charge | 2 |
| Atom Count | 136 |
| Chiral Atom Count | 8 |
| Bond Count | 144 |
| Aromatic Bond Count | 5 |
Drug Info: DrugBank
| DrugBank ID | DB04506 |
|---|---|
| Name | Chlorophyll B |
| Groups | experimental |
| Description | A light, silvery, metallic element. It has the atomic symbol Mg, atomic number 12, and atomic weight 24.31. Its salts are essential in nutrition, being required for the activity of many enzymes, especially those concerned with oxidative phosphorylation. It is a component of both intra- and extracellular fluids and is excreted in the urine and feces. Deficiency causes irritability of the nervous system with tetany, vasodilation, convulsions, tremors, depression, and psychotic behavior. (From Dorland, 27th ed) |
| Synonyms | Chlorophyll B |
| Categories | Heterocyclic Compounds, Fused-Ring |
| CAS number | 519-62-0 |
